| Name | 1-penten-3-ol |
| Synonyms | FEMA 2584 FEMA 3584 1-PENTEN-3-OL 1-penten-3-ol 1-Pentene-3-ol pent-1-en-3-ol (±)-pent-1-en-3-ol ETHYL VINYL ALCOHOL (3R)-pent-1-en-3-ol (3S)-pent-1-en-3-ol Ethyl vinyl carbinol ETHYL VINYL CARBINOL alpha-Ethylallyl alcohol |
| CAS | 616-25-1 |
| EINECS | 210-472-1 |
| InChI | InChI=1/C5H10O/c1-3-5(6)4-2/h3,5-6H,1,4H2,2H3/t5-/m1/s1 |
| InChIKey | VHVMXWZXFBOANQ-UHFFFAOYSA-N |
| Molecular Formula | C5H10O |
| Molar Mass | 86.13 |
| Density | 0.838 g/mL at 20 °C (lit.)0.839 g/mL at 25 °C (lit.) |
| Melting Point | 14.19°C (estimate) |
| Boling Point | 114-115 °C (lit.) |
| Flash Point | 77°F |
| JECFA Number | 1150 |
| Water Solubility | Slightly soluble in water |
| Solubility | 90.1g/l |
| Vapor Presure | 11.2mmHg at 25°C |
| Appearance | Powder |
| Color | Light yellow to beige |
| BRN | 1719834 |
| pKa | 14.49±0.20(Predicted) |
| Storage Condition | Sealed in dry,2-8°C |
| Stability | Stable. Flammable - note flashpoint is close to room temperature. Incompatible with strong oxidizing agents. |
| Refractive Index | n20/D 1.424(lit.) |
| Physical and Chemical Properties | Colorless to light yellow liquid with fruit aroma. Boiling point 114 degrees C, flash point 28 degrees Celsius. Relative density (d425)0.8344, refractive index (nD25)1.4223; Optical rotation, d-type [α] D 10.5 ° (in ethanol),l-type [α] D-7.1 ° (in ethanol). Slightly soluble in water, miscible in ethanol, ether. Natural products are found in oranges, strawberries, tomatoes, etc. |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R10 - Flammable R37 - Irritating to the respiratory system R20 - Harmful by inhalation |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. S16 - Keep away from sources of ignition. |
| UN IDs | UN 1987 3/PG 3 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29052900 |
| Hazard Class | 3 |
| Packing Group | III |
| FEMA | 3584 | 1-PENTEN-3-OL |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| toxicity | can be safely used in food (FDA, l72.515,2000). |
| usage limit | FEMA(mg/kg): baked goods 8.8; Cold drinks, jelly and pudding, 4.3; Soft candy 5.0; Alcohol-free beverage 3.5; Alcohol-containing beverage 2.0. |
| use | GB 2760-1996 specified as allowed food spices. |
| Production method | It is formed by 1-chloro-2-pentene after long-term contact with sodium hydroxide solution. |